C24H42O10S3 — CID 58426016
[2-[3-[3-[2-(2-ethoxyethoxy)ethoxy]-3-oxopropyl]sulfanylpropanoyloxymethyl]-2-(3-sulfanylpropanoyloxymethyl)butyl] 3-sulfanylpropanoate (PubChem CID 58426016) has the molecular formula C24H42O10S3 and a molecular weight of 586.79 g/mol. Its IUPAC name is [2-[3-[3-[2-(2-ethoxyethoxy)ethoxy]-3-oxopropyl]sulfanylpropanoyloxymethyl]-2-(3-sulfanylpropanoyloxymethyl)butyl] 3-sulfanylpropanoate.
| Compound Name | [2-[3-[3-[2-(2-ethoxyethoxy)ethoxy]-3-oxopropyl]sulfanylpropanoyloxymethyl]-2-(3-sulfanylpropanoyloxymethyl)butyl] 3-sulfanylpropanoate |
|---|---|
| PubChem CID | 58426016 |
| Molecular Formula | C24H42O10S3 |
| Molecular Weight | 586.79 g/mol |
| Exact Mass | 586.19 |
| IUPAC Name | [2-[3-[3-[2-(2-ethoxyethoxy)ethoxy]-3-oxopropyl]sulfanylpropanoyloxymethyl]-2-(3-sulfanylpropanoyloxymethyl)butyl] 3-sulfanylpropanoate |
| SMILES | CCOCCOCCOC(=O)CCSCCC(=O)OCC(CC)(COC(=O)CCS)COC(=O)CCS |
| InChI | InChI=1S/C24H42O10S3/c1-3-24(17-32-20(25)5-13-35,18-33-21(26)6-14-36)19-34-23(28)8-16-37-15-7-22(27)31-12-11-30-10-9-29-4-2/h35-36H,3-19H2,1-2H3 |
| InChIKey | YLDVAWWTKZUKOK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 123.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.79 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|