C25H44O8S4 — CID 166909873
[3-(3-ethylsulfanylpropanoyloxy)-2,2-bis(3-ethylsulfanylpropanoyloxymethyl)propyl] 3-ethylsulfanylpropanoate (PubChem CID 166909873) has the molecular formula C25H44O8S4 and a molecular weight of 600.89 g/mol. Its IUPAC name is [3-(3-ethylsulfanylpropanoyloxy)-2,2-bis(3-ethylsulfanylpropanoyloxymethyl)propyl] 3-ethylsulfanylpropanoate.
| Compound Name | [3-(3-ethylsulfanylpropanoyloxy)-2,2-bis(3-ethylsulfanylpropanoyloxymethyl)propyl] 3-ethylsulfanylpropanoate |
|---|---|
| PubChem CID | 166909873 |
| Molecular Formula | C25H44O8S4 |
| Molecular Weight | 600.89 g/mol |
| Exact Mass | 600.19 |
| IUPAC Name | [3-(3-ethylsulfanylpropanoyloxy)-2,2-bis(3-ethylsulfanylpropanoyloxymethyl)propyl] 3-ethylsulfanylpropanoate |
| SMILES | CCSCCC(=O)OCC(COC(=O)CCSCC)(COC(=O)CCSCC)COC(=O)CCSCC |
| InChI | InChI=1S/C25H44O8S4/c1-5-34-13-9-21(26)30-17-25(18-31-22(27)10-14-35-6-2,19-32-23(28)11-15-36-7-3)20-33-24(29)12-16-37-8-4/h5-20H2,1-4H3 |
| InChIKey | ODGMLLGFNGICTO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.89 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|