C25H46O12S4 — CID 146766427
[2-[3-[3-[2-(2-methoxysulfonyloxyethoxy)butoxy]propylsulfanyl]propanoyloxymethyl]-2-(3-sulfanylpropanoyloxymethyl)butyl] 3-sulfanylpropanoate (PubChem CID 146766427) has the molecular formula C25H46O12S4 and a molecular weight of 666.90 g/mol. Its IUPAC name is [2-[3-[3-[2-(2-methoxysulfonyloxyethoxy)butoxy]propylsulfanyl]propanoyloxymethyl]-2-(3-sulfanylpropanoyloxymethyl)butyl] 3-sulfanylpropanoate.
| Compound Name | [2-[3-[3-[2-(2-methoxysulfonyloxyethoxy)butoxy]propylsulfanyl]propanoyloxymethyl]-2-(3-sulfanylpropanoyloxymethyl)butyl] 3-sulfanylpropanoate |
|---|---|
| PubChem CID | 146766427 |
| Molecular Formula | C25H46O12S4 |
| Molecular Weight | 666.90 g/mol |
| Exact Mass | 666.19 |
| IUPAC Name | [2-[3-[3-[2-(2-methoxysulfonyloxyethoxy)butoxy]propylsulfanyl]propanoyloxymethyl]-2-(3-sulfanylpropanoyloxymethyl)butyl] 3-sulfanylpropanoate |
| SMILES | CCC(COCCCSCCC(=O)OCC(CC)(COC(=O)CCS)COC(=O)CCS)OCCOS(=O)(=O)OC |
| InChI | InChI=1S/C25H46O12S4/c1-4-21(33-11-12-37-41(29,30)31-3)17-32-10-6-15-40-16-9-24(28)36-20-25(5-2,18-34-22(26)7-13-38)19-35-23(27)8-14-39/h21,38-39H,4-20H2,1-3H3 |
| InChIKey | RQSCDAKRPHTFAE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 149.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.90 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|