C23H42O9S3 — CID 134412888
[2-[3-[3-[2-(2-hydroxyethoxy)propoxy]propylsulfanyl]propanoyloxymethyl]-2-(3-sulfanylpropanoyloxymethyl)butyl] 3-sulfanylpropanoate (PubChem CID 134412888) has the molecular formula C23H42O9S3 and a molecular weight of 558.78 g/mol. Its IUPAC name is [2-[3-[3-[2-(2-hydroxyethoxy)propoxy]propylsulfanyl]propanoyloxymethyl]-2-(3-sulfanylpropanoyloxymethyl)butyl] 3-sulfanylpropanoate.
| Compound Name | [2-[3-[3-[2-(2-hydroxyethoxy)propoxy]propylsulfanyl]propanoyloxymethyl]-2-(3-sulfanylpropanoyloxymethyl)butyl] 3-sulfanylpropanoate |
|---|---|
| PubChem CID | 134412888 |
| Molecular Formula | C23H42O9S3 |
| Molecular Weight | 558.78 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | [2-[3-[3-[2-(2-hydroxyethoxy)propoxy]propylsulfanyl]propanoyloxymethyl]-2-(3-sulfanylpropanoyloxymethyl)butyl] 3-sulfanylpropanoate |
| SMILES | CCC(COC(=O)CCS)(COC(=O)CCS)COC(=O)CCSCCCOCC(C)OCCO |
| InChI | InChI=1S/C23H42O9S3/c1-3-23(16-30-20(25)5-11-33,17-31-21(26)6-12-34)18-32-22(27)7-14-35-13-4-9-28-15-19(2)29-10-8-24/h19,24,33-34H,3-18H2,1-2H3 |
| InChIKey | WCJJTJQQNBEYTL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.78 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|