C11H18O6S2 — CID 3017743
2-methyl-3-(3-sulfanylpropanoyloxy)-2-(3-sulfanylpropanoyloxymethyl)propanoic acid (PubChem CID 3017743) has the molecular formula C11H18O6S2 and a molecular weight of 310.39 g/mol. Its IUPAC name is 2-methyl-3-(3-sulfanylpropanoyloxy)-2-(3-sulfanylpropanoyloxymethyl)propanoic acid.
| Compound Name | 2-methyl-3-(3-sulfanylpropanoyloxy)-2-(3-sulfanylpropanoyloxymethyl)propanoic acid |
|---|---|
| PubChem CID | 3017743 |
| Molecular Formula | C11H18O6S2 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 2-methyl-3-(3-sulfanylpropanoyloxy)-2-(3-sulfanylpropanoyloxymethyl)propanoic acid |
| SMILES | CC(COC(=O)CCS)(COC(=O)CCS)C(=O)O |
| InChI | InChI=1S/C11H18O6S2/c1-11(10(14)15,6-16-8(12)2-4-18)7-17-9(13)3-5-19/h18-19H,2-7H2,1H3,(H,14,15) |
| InChIKey | WFYBQZGINNOOHO-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|