3-butanoyloxy-2,2-dimethylpropanoic acid

C9H16O4 — CID 54315493

IUPAC3-butanoyloxy-2,2-dimethylpropanoic acid
SMILESCCCC(=O)OCC(C)(C)C(=O)O
InChIInChI=1S/C9H16O4/c1-4-5-7(10)13-6-9(2,3)8(11)12/h4-6H2,1-3H3,(H,11,12)
InChIKeyJTMLIHIIEGWEDW-UHFFFAOYSA-N
MW188.22 g/mol
LogP1.44
Rot. Bonds5

About 3-butanoyloxy-2,2-dimethylpropanoic acid

3-butanoyloxy-2,2-dimethylpropanoic acid (PubChem CID 54315493) has the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. Its IUPAC name is 3-butanoyloxy-2,2-dimethylpropanoic acid.

Molecular Properties

Compound Name3-butanoyloxy-2,2-dimethylpropanoic acid
PubChem CID54315493
Molecular FormulaC9H16O4
Molecular Weight188.22 g/mol
Exact Mass188.10
IUPAC Name3-butanoyloxy-2,2-dimethylpropanoic acid
SMILESCCCC(=O)OCC(C)(C)C(=O)O
InChIInChI=1S/C9H16O4/c1-4-5-7(10)13-6-9(2,3)8(11)12/h4-6H2,1-3H3,(H,11,12)
InChIKeyJTMLIHIIEGWEDW-UHFFFAOYSA-N
XLogP1.44
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.22
LogP ≤ 51.44
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-butanoyloxy-2,2-dimethylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-butanoyloxy-2,2-dimethylpropanoic acid?
The IUPAC name of 3-butanoyloxy-2,2-dimethylpropanoic acid (CID 54315493) is 3-butanoyloxy-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-butanoyloxy-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-butanoyloxy-2,2-dimethylpropanoic acid is CCCC(=O)OCC(C)(C)C(=O)O.
What is the InChIKey of 3-butanoyloxy-2,2-dimethylpropanoic acid?
The InChIKey is JTMLIHIIEGWEDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4/c1-4-5-7(10)13-6-9(2,3)8(11)12/h4-6H2,1-3H3,(H,11,12).
What are the key properties of 3-butanoyloxy-2,2-dimethylpropanoic acid?
3-butanoyloxy-2,2-dimethylpropanoic acid has a molecular weight of 188.22 g/mol, XLogP of 1.44, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butanoyloxy-2,2-dimethylpropanoic acid is sourced from PubChem (CID 54315493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).