C20H35NO8 — CID 135233988
[2,2-bis(butanoyloxymethyl)-3-[2-(methylamino)acetyl]oxypropyl] butanoate (PubChem CID 135233988) has the molecular formula C20H35NO8 and a molecular weight of 417.50 g/mol. Its IUPAC name is [2,2-bis(butanoyloxymethyl)-3-[2-(methylamino)acetyl]oxypropyl] butanoate.
| Compound Name | [2,2-bis(butanoyloxymethyl)-3-[2-(methylamino)acetyl]oxypropyl] butanoate |
|---|---|
| PubChem CID | 135233988 |
| Molecular Formula | C20H35NO8 |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | [2,2-bis(butanoyloxymethyl)-3-[2-(methylamino)acetyl]oxypropyl] butanoate |
| SMILES | CCCC(=O)OCC(COC(=O)CCC)(COC(=O)CCC)COC(=O)CNC |
| InChI | InChI=1S/C20H35NO8/c1-5-8-16(22)26-12-20(13-27-17(23)9-6-2,14-28-18(24)10-7-3)15-29-19(25)11-21-4/h21H,5-15H2,1-4H3 |
| InChIKey | FUOGBYVLIHHDPP-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|