C36H62O12 — CID 130418328
2,2-bis(6-butanoyloxyhexanoyloxymethyl)butyl 6-butanoyloxyhexanoate (PubChem CID 130418328) has the molecular formula C36H62O12 and a molecular weight of 686.88 g/mol. Its IUPAC name is 2,2-bis(6-butanoyloxyhexanoyloxymethyl)butyl 6-butanoyloxyhexanoate.
| Compound Name | 2,2-bis(6-butanoyloxyhexanoyloxymethyl)butyl 6-butanoyloxyhexanoate |
|---|---|
| PubChem CID | 130418328 |
| Molecular Formula | C36H62O12 |
| Molecular Weight | 686.88 g/mol |
| Exact Mass | 686.42 |
| IUPAC Name | 2,2-bis(6-butanoyloxyhexanoyloxymethyl)butyl 6-butanoyloxyhexanoate |
| SMILES | CCCC(=O)OCCCCCC(=O)OCC(CC)(COC(=O)CCCCCOC(=O)CCC)COC(=O)CCCCCOC(=O)CCC |
| InChI | InChI=1S/C36H62O12/c1-5-18-30(37)43-24-15-9-12-21-33(40)46-27-36(8-4,28-47-34(41)22-13-10-16-25-44-31(38)19-6-2)29-48-35(42)23-14-11-17-26-45-32(39)20-7-3/h5-29H2,1-4H3 |
| InChIKey | GVPBJWRHAJZGTC-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.88 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|