C13H22Br2O4 — CID 54115753
[2,2-bis(bromomethyl)-3-butanoyloxypropyl] butanoate (PubChem CID 54115753) has the molecular formula C13H22Br2O4 and a molecular weight of 402.12 g/mol. Its IUPAC name is [2,2-bis(bromomethyl)-3-butanoyloxypropyl] butanoate.
| Compound Name | [2,2-bis(bromomethyl)-3-butanoyloxypropyl] butanoate |
|---|---|
| PubChem CID | 54115753 |
| Molecular Formula | C13H22Br2O4 |
| Molecular Weight | 402.12 g/mol |
| Exact Mass | 399.99 |
| IUPAC Name | [2,2-bis(bromomethyl)-3-butanoyloxypropyl] butanoate |
| SMILES | CCCC(=O)OCC(CBr)(CBr)COC(=O)CCC |
| InChI | InChI=1S/C13H22Br2O4/c1-3-5-11(16)18-9-13(7-14,8-15)10-19-12(17)6-4-2/h3-10H2,1-2H3 |
| InChIKey | NKFQYUVZVPJBRB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.12 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|