C12H20Br2O4 — CID 171629102
[2,2-bis(bromomethyl)-3-propanoyloxypropyl] 2-methylpropanoate (PubChem CID 171629102) has the molecular formula C12H20Br2O4 and a molecular weight of 388.10 g/mol. Its IUPAC name is [2,2-bis(bromomethyl)-3-propanoyloxypropyl] 2-methylpropanoate.
| Compound Name | [2,2-bis(bromomethyl)-3-propanoyloxypropyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 171629102 |
| Molecular Formula | C12H20Br2O4 |
| Molecular Weight | 388.10 g/mol |
| Exact Mass | 385.97 |
| IUPAC Name | [2,2-bis(bromomethyl)-3-propanoyloxypropyl] 2-methylpropanoate |
| SMILES | CCC(=O)OCC(CBr)(CBr)COC(=O)C(C)C |
| InChI | InChI=1S/C12H20Br2O4/c1-4-10(15)17-7-12(5-13,6-14)8-18-11(16)9(2)3/h9H,4-8H2,1-3H3 |
| InChIKey | KNMCLSJSODBSGR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.10 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|