C9H15Br3O2 — CID 171629069
[3-bromo-2,2-bis(bromomethyl)propyl] 2-methylpropanoate (PubChem CID 171629069) has the molecular formula C9H15Br3O2 and a molecular weight of 394.93 g/mol. Its IUPAC name is [3-bromo-2,2-bis(bromomethyl)propyl] 2-methylpropanoate.
| Compound Name | [3-bromo-2,2-bis(bromomethyl)propyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 171629069 |
| Molecular Formula | C9H15Br3O2 |
| Molecular Weight | 394.93 g/mol |
| Exact Mass | 391.86 |
| IUPAC Name | [3-bromo-2,2-bis(bromomethyl)propyl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCC(CBr)(CBr)CBr |
| InChI | InChI=1S/C9H15Br3O2/c1-7(2)8(13)14-6-9(3-10,4-11)5-12/h7H,3-6H2,1-2H3 |
| InChIKey | AYJMVEORIRIQTR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.93 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|