About [(3S)-3-methoxy-2,2,4-trimethylpentyl] 2-methylpropanoate
[(3S)-3-methoxy-2,2,4-trimethylpentyl] 2-methylpropanoate (PubChem CID 89335990) has the molecular formula C13H26O3
and a molecular weight of 230.35 g/mol. Its IUPAC name is [(3S)-3-methoxy-2,2,4-trimethylpentyl] 2-methylpropanoate.
Analyze [(3S)-3-methoxy-2,2,4-trimethylpentyl] 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-3-methoxy-2,2,4-trimethylpentyl] 2-methylpropanoate?
The IUPAC name of [(3S)-3-methoxy-2,2,4-trimethylpentyl] 2-methylpropanoate (CID 89335990) is [(3S)-3-methoxy-2,2,4-trimethylpentyl] 2-methylpropanoate.
What is the SMILES notation for [(3S)-3-methoxy-2,2,4-trimethylpentyl] 2-methylpropanoate?
The canonical SMILES for [(3S)-3-methoxy-2,2,4-trimethylpentyl] 2-methylpropanoate is CO[C@@H](C(C)C)C(C)(C)COC(=O)C(C)C.
What is the InChIKey of [(3S)-3-methoxy-2,2,4-trimethylpentyl] 2-methylpropanoate?
The InChIKey is JYCPQHIHVJRQSR-NSHDSACASA-N. The full InChI is InChI=1S/C13H26O3/c1-9(2)11(15-7)13(5,6)8-16-12(14)10(3)4/h9-11H,8H2,1-7H3/t11-/m0/s1.
What are the key properties of [(3S)-3-methoxy-2,2,4-trimethylpentyl] 2-methylpropanoate?
[(3S)-3-methoxy-2,2,4-trimethylpentyl] 2-methylpropanoate has a molecular weight of 230.35 g/mol, XLogP of 2.88, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-3-methoxy-2,2,4-trimethylpentyl] 2-methylpropanoate is sourced from PubChem (CID 89335990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).