C32H50O8 — CID 67882160
bis[2,2,4-trimethyl-1-(2-methylpropanoyloxy)pentan-3-yl] benzene-1,2-dicarboxylate (PubChem CID 67882160) has the molecular formula C32H50O8 and a molecular weight of 562.74 g/mol. Its IUPAC name is bis[2,2,4-trimethyl-1-(2-methylpropanoyloxy)pentan-3-yl] benzene-1,2-dicarboxylate.
| Compound Name | bis[2,2,4-trimethyl-1-(2-methylpropanoyloxy)pentan-3-yl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 67882160 |
| Molecular Formula | C32H50O8 |
| Molecular Weight | 562.74 g/mol |
| Exact Mass | 562.35 |
| IUPAC Name | bis[2,2,4-trimethyl-1-(2-methylpropanoyloxy)pentan-3-yl] benzene-1,2-dicarboxylate |
| SMILES | CC(C)C(=O)OCC(C)(C)C(OC(=O)c1ccccc1C(=O)OC(C(C)C)C(C)(C)COC(=O)C(C)C)C(C)C |
| InChI | InChI=1S/C32H50O8/c1-19(2)25(31(9,10)17-37-27(33)21(5)6)39-29(35)23-15-13-14-16-24(23)30(36)40-26(20(3)4)32(11,12)18-38-28(34)22(7)8/h13-16,19-22,25-26H,17-18H2,1-12H3 |
| InChIKey | WVBQBNXIWMUXOU-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.74 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|