C46H62O8 — CID 66627159
bis[2,4,4-trimethyl-5-(2-methylpropanoyloxy)-6-phenylhexan-3-yl] benzene-1,2-dicarboxylate (PubChem CID 66627159) has the molecular formula C46H62O8 and a molecular weight of 742.99 g/mol. Its IUPAC name is bis[2,4,4-trimethyl-5-(2-methylpropanoyloxy)-6-phenylhexan-3-yl] benzene-1,2-dicarboxylate.
| Compound Name | bis[2,4,4-trimethyl-5-(2-methylpropanoyloxy)-6-phenylhexan-3-yl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 66627159 |
| Molecular Formula | C46H62O8 |
| Molecular Weight | 742.99 g/mol |
| Exact Mass | 742.44 |
| IUPAC Name | bis[2,4,4-trimethyl-5-(2-methylpropanoyloxy)-6-phenylhexan-3-yl] benzene-1,2-dicarboxylate |
| SMILES | CC(C)C(=O)OC(Cc1ccccc1)C(C)(C)C(OC(=O)c1ccccc1C(=O)OC(C(C)C)C(C)(C)C(Cc1ccccc1)OC(=O)C(C)C)C(C)C |
| InChI | InChI=1S/C46H62O8/c1-29(2)39(45(9,10)37(51-41(47)31(5)6)27-33-21-15-13-16-22-33)53-43(49)35-25-19-20-26-36(35)44(50)54-40(30(3)4)46(11,12)38(52-42(48)32(7)8)28-34-23-17-14-18-24-34/h13-26,29-32,37-40H,27-28H2,1-12H3 |
| InChIKey | CCCHCOHMIRIWEP-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.99 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|