C16H25NO2 — CID 121462821
[(2S,3R)-3-benzyl-4-methylpentan-2-yl] (2S)-2-aminopropanoate (PubChem CID 121462821) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is [(2S,3R)-3-benzyl-4-methylpentan-2-yl] (2S)-2-aminopropanoate.
| Compound Name | [(2S,3R)-3-benzyl-4-methylpentan-2-yl] (2S)-2-aminopropanoate |
|---|---|
| PubChem CID | 121462821 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | [(2S,3R)-3-benzyl-4-methylpentan-2-yl] (2S)-2-aminopropanoate |
| SMILES | CC(C)[C@@H](Cc1ccccc1)[C@H](C)OC(=O)[C@H](C)N |
| InChI | InChI=1S/C16H25NO2/c1-11(2)15(10-14-8-6-5-7-9-14)13(4)19-16(18)12(3)17/h5-9,11-13,15H,10,17H2,1-4H3/t12-,13-,15+/m0/s1 |
| InChIKey | RYSKGLUZEQNDBP-KCQAQPDRSA-N |
| XLogP | 2.78 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |