C14H20N2O2 — CID 57124775
(2S,5S)-2,5-diamino-6-methyl-1-phenylheptane-3,4-dione (PubChem CID 57124775) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is (2S,5S)-2,5-diamino-6-methyl-1-phenylheptane-3,4-dione.
| Compound Name | (2S,5S)-2,5-diamino-6-methyl-1-phenylheptane-3,4-dione |
|---|---|
| PubChem CID | 57124775 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | (2S,5S)-2,5-diamino-6-methyl-1-phenylheptane-3,4-dione |
| SMILES | CC(C)[C@H](N)C(=O)C(=O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C14H20N2O2/c1-9(2)12(16)14(18)13(17)11(15)8-10-6-4-3-5-7-10/h3-7,9,11-12H,8,15-16H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | RWSFYDKUBVWQAI-RYUDHWBXSA-N |
| XLogP | 0.68 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|