C42H48O8 — CID 175392349
bis(4-methylpentan-2-yl) benzene-1,2-dicarboxylate;dibenzyl benzene-1,2-dicarboxylate (PubChem CID 175392349) has the molecular formula C42H48O8 and a molecular weight of 680.84 g/mol. Its IUPAC name is bis(4-methylpentan-2-yl) benzene-1,2-dicarboxylate;dibenzyl benzene-1,2-dicarboxylate.
| Compound Name | bis(4-methylpentan-2-yl) benzene-1,2-dicarboxylate;dibenzyl benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 175392349 |
| Molecular Formula | C42H48O8 |
| Molecular Weight | 680.84 g/mol |
| Exact Mass | 680.33 |
| IUPAC Name | bis(4-methylpentan-2-yl) benzene-1,2-dicarboxylate;dibenzyl benzene-1,2-dicarboxylate |
| SMILES | CC(C)CC(C)OC(=O)c1ccccc1C(=O)OC(C)CC(C)C.O=C(OCc1ccccc1)c1ccccc1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H18O4.C20H30O4/c23-21(25-15-17-9-3-1-4-10-17)19-13-7-8-14-20(19)22(24)26-16-18-11-5-2-6-12-18;1-13(2)11-15(5)23-19(21)17-9-7-8-10-18(17)20(22)24-16(6)12-14(3)4/h1-14H,15-16H2;7-10,13-16H,11-12H2,1-6H3 |
| InChIKey | YRSKGCPNSNVSTI-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.84 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|