About 4-methylpentan-2-yl 2-aminobenzoate
4-methylpentan-2-yl 2-aminobenzoate (PubChem CID 61278616) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is 4-methylpentan-2-yl 2-aminobenzoate.
Molecular Properties
| Compound Name | 4-methylpentan-2-yl 2-aminobenzoate |
| PubChem CID | 61278616 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 4-methylpentan-2-yl 2-aminobenzoate |
| SMILES | CC(C)CC(C)OC(=O)c1ccccc1N |
| InChI | InChI=1S/C13H19NO2/c1-9(2)8-10(3)16-13(15)11-6-4-5-7-12(11)14/h4-7,9-10H,8,14H2,1-3H3 |
| InChIKey | YPFGCNUSLQMVGY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-methylpentan-2-yl 2-aminobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpentan-2-yl 2-aminobenzoate?
The IUPAC name of 4-methylpentan-2-yl 2-aminobenzoate (CID 61278616) is 4-methylpentan-2-yl 2-aminobenzoate.
What is the SMILES notation for 4-methylpentan-2-yl 2-aminobenzoate?
The canonical SMILES for 4-methylpentan-2-yl 2-aminobenzoate is CC(C)CC(C)OC(=O)c1ccccc1N.
What is the InChIKey of 4-methylpentan-2-yl 2-aminobenzoate?
The InChIKey is YPFGCNUSLQMVGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2/c1-9(2)8-10(3)16-13(15)11-6-4-5-7-12(11)14/h4-7,9-10H,8,14H2,1-3H3.
What are the key properties of 4-methylpentan-2-yl 2-aminobenzoate?
4-methylpentan-2-yl 2-aminobenzoate has a molecular weight of 221.30 g/mol, XLogP of 2.86, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpentan-2-yl 2-aminobenzoate is sourced from PubChem (CID 61278616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).