C10H13NO4 — CID 67638206
1,3-dihydroxypropan-2-yl 2-aminobenzoate (PubChem CID 67638206) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is 1,3-dihydroxypropan-2-yl 2-aminobenzoate.
| Compound Name | 1,3-dihydroxypropan-2-yl 2-aminobenzoate |
|---|---|
| PubChem CID | 67638206 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 1,3-dihydroxypropan-2-yl 2-aminobenzoate |
| SMILES | Nc1ccccc1C(=O)OC(CO)CO |
| InChI | InChI=1S/C10H13NO4/c11-9-4-2-1-3-8(9)10(14)15-7(5-12)6-13/h1-4,7,12-13H,5-6,11H2 |
| InChIKey | RVQVIKHTWXDXTA-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|