About 2-(3-methylbutoxy)ethyl 2-aminobenzoate
2-(3-methylbutoxy)ethyl 2-aminobenzoate (PubChem CID 54956515) has the molecular formula C14H21NO3
and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-(3-methylbutoxy)ethyl 2-aminobenzoate.
Molecular Properties
| Compound Name | 2-(3-methylbutoxy)ethyl 2-aminobenzoate |
| PubChem CID | 54956515 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 2-(3-methylbutoxy)ethyl 2-aminobenzoate |
| SMILES | CC(C)CCOCCOC(=O)c1ccccc1N |
| InChI | InChI=1S/C14H21NO3/c1-11(2)7-8-17-9-10-18-14(16)12-5-3-4-6-13(12)15/h3-6,11H,7-10,15H2,1-2H3 |
| InChIKey | FVDYFFCAMPNEAA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methylbutoxy)ethyl 2-aminobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methylbutoxy)ethyl 2-aminobenzoate?
The IUPAC name of 2-(3-methylbutoxy)ethyl 2-aminobenzoate (CID 54956515) is 2-(3-methylbutoxy)ethyl 2-aminobenzoate.
What is the SMILES notation for 2-(3-methylbutoxy)ethyl 2-aminobenzoate?
The canonical SMILES for 2-(3-methylbutoxy)ethyl 2-aminobenzoate is CC(C)CCOCCOC(=O)c1ccccc1N.
What is the InChIKey of 2-(3-methylbutoxy)ethyl 2-aminobenzoate?
The InChIKey is FVDYFFCAMPNEAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO3/c1-11(2)7-8-17-9-10-18-14(16)12-5-3-4-6-13(12)15/h3-6,11H,7-10,15H2,1-2H3.
What are the key properties of 2-(3-methylbutoxy)ethyl 2-aminobenzoate?
2-(3-methylbutoxy)ethyl 2-aminobenzoate has a molecular weight of 251.33 g/mol, XLogP of 2.49, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methylbutoxy)ethyl 2-aminobenzoate is sourced from PubChem (CID 54956515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).