About 3-hydroxypentyl 2-aminobenzoate
3-hydroxypentyl 2-aminobenzoate (PubChem CID 141469821) has the molecular formula C12H17NO3
and a molecular weight of 223.27 g/mol. Its IUPAC name is 3-hydroxypentyl 2-aminobenzoate.
Molecular Properties
| Compound Name | 3-hydroxypentyl 2-aminobenzoate |
| PubChem CID | 141469821 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 3-hydroxypentyl 2-aminobenzoate |
| SMILES | CCC(O)CCOC(=O)c1ccccc1N |
| InChI | InChI=1S/C12H17NO3/c1-2-9(14)7-8-16-12(15)10-5-3-4-6-11(10)13/h3-6,9,14H,2,7-8,13H2,1H3 |
| InChIKey | SAMCNSUHUFYUDQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxypentyl 2-aminobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxypentyl 2-aminobenzoate?
The IUPAC name of 3-hydroxypentyl 2-aminobenzoate (CID 141469821) is 3-hydroxypentyl 2-aminobenzoate.
What is the SMILES notation for 3-hydroxypentyl 2-aminobenzoate?
The canonical SMILES for 3-hydroxypentyl 2-aminobenzoate is CCC(O)CCOC(=O)c1ccccc1N.
What is the InChIKey of 3-hydroxypentyl 2-aminobenzoate?
The InChIKey is SAMCNSUHUFYUDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO3/c1-2-9(14)7-8-16-12(15)10-5-3-4-6-11(10)13/h3-6,9,14H,2,7-8,13H2,1H3.
What are the key properties of 3-hydroxypentyl 2-aminobenzoate?
3-hydroxypentyl 2-aminobenzoate has a molecular weight of 223.27 g/mol, XLogP of 1.59, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxypentyl 2-aminobenzoate is sourced from PubChem (CID 141469821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).