About 1-hydroxypropyl 2-aminobenzoate
1-hydroxypropyl 2-aminobenzoate (PubChem CID 22287850) has the molecular formula C10H13NO3
and a molecular weight of 195.22 g/mol. Its IUPAC name is 1-hydroxypropyl 2-aminobenzoate.
Molecular Properties
| Compound Name | 1-hydroxypropyl 2-aminobenzoate |
| PubChem CID | 22287850 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 1-hydroxypropyl 2-aminobenzoate |
| SMILES | CCC(O)OC(=O)c1ccccc1N |
| InChI | InChI=1S/C10H13NO3/c1-2-9(12)14-10(13)7-5-3-4-6-8(7)11/h3-6,9,12H,2,11H2,1H3 |
| InChIKey | VLPXXYHVZXPNQM-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxypropyl 2-aminobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxypropyl 2-aminobenzoate?
The IUPAC name of 1-hydroxypropyl 2-aminobenzoate (CID 22287850) is 1-hydroxypropyl 2-aminobenzoate.
What is the SMILES notation for 1-hydroxypropyl 2-aminobenzoate?
The canonical SMILES for 1-hydroxypropyl 2-aminobenzoate is CCC(O)OC(=O)c1ccccc1N.
What is the InChIKey of 1-hydroxypropyl 2-aminobenzoate?
The InChIKey is VLPXXYHVZXPNQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3/c1-2-9(12)14-10(13)7-5-3-4-6-8(7)11/h3-6,9,12H,2,11H2,1H3.
What are the key properties of 1-hydroxypropyl 2-aminobenzoate?
1-hydroxypropyl 2-aminobenzoate has a molecular weight of 195.22 g/mol, XLogP of 1.15, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxypropyl 2-aminobenzoate is sourced from PubChem (CID 22287850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).