About methylsulfanylmethyl 2-aminobenzoate
methylsulfanylmethyl 2-aminobenzoate (PubChem CID 67665029) has the molecular formula C9H11NO2S
and a molecular weight of 197.26 g/mol. Its IUPAC name is methylsulfanylmethyl 2-aminobenzoate.
Molecular Properties
| Compound Name | methylsulfanylmethyl 2-aminobenzoate |
| PubChem CID | 67665029 |
| Molecular Formula | C9H11NO2S |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | methylsulfanylmethyl 2-aminobenzoate |
| SMILES | CSCOC(=O)c1ccccc1N |
| InChI | InChI=1S/C9H11NO2S/c1-13-6-12-9(11)7-4-2-3-5-8(7)10/h2-5H,6,10H2,1H3 |
| InChIKey | NSEUWMOUQPKCTQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methylsulfanylmethyl 2-aminobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylsulfanylmethyl 2-aminobenzoate?
The IUPAC name of methylsulfanylmethyl 2-aminobenzoate (CID 67665029) is methylsulfanylmethyl 2-aminobenzoate.
What is the SMILES notation for methylsulfanylmethyl 2-aminobenzoate?
The canonical SMILES for methylsulfanylmethyl 2-aminobenzoate is CSCOC(=O)c1ccccc1N.
What is the InChIKey of methylsulfanylmethyl 2-aminobenzoate?
The InChIKey is NSEUWMOUQPKCTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2S/c1-13-6-12-9(11)7-4-2-3-5-8(7)10/h2-5H,6,10H2,1H3.
What are the key properties of methylsulfanylmethyl 2-aminobenzoate?
methylsulfanylmethyl 2-aminobenzoate has a molecular weight of 197.26 g/mol, XLogP of 1.75, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methylsulfanylmethyl 2-aminobenzoate is sourced from PubChem (CID 67665029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).