C28H38N4O8 — CID 70585208
2-[2-[[6-[2-[2-(2-aminobenzoyl)oxyethoxy]ethylamino]-6-oxohexanoyl]amino]ethoxy]ethyl 2-aminobenzoate (PubChem CID 70585208) has the molecular formula C28H38N4O8 and a molecular weight of 558.63 g/mol. Its IUPAC name is 2-[2-[[6-[2-[2-(2-aminobenzoyl)oxyethoxy]ethylamino]-6-oxohexanoyl]amino]ethoxy]ethyl 2-aminobenzoate.
| Compound Name | 2-[2-[[6-[2-[2-(2-aminobenzoyl)oxyethoxy]ethylamino]-6-oxohexanoyl]amino]ethoxy]ethyl 2-aminobenzoate |
|---|---|
| PubChem CID | 70585208 |
| Molecular Formula | C28H38N4O8 |
| Molecular Weight | 558.63 g/mol |
| Exact Mass | 558.27 |
| IUPAC Name | 2-[2-[[6-[2-[2-(2-aminobenzoyl)oxyethoxy]ethylamino]-6-oxohexanoyl]amino]ethoxy]ethyl 2-aminobenzoate |
| SMILES | Nc1ccccc1C(=O)OCCOCCNC(=O)CCCCC(=O)NCCOCCOC(=O)c1ccccc1N |
| InChI | InChI=1S/C28H38N4O8/c29-23-9-3-1-7-21(23)27(35)39-19-17-37-15-13-31-25(33)11-5-6-12-26(34)32-14-16-38-18-20-40-28(36)22-8-2-4-10-24(22)30/h1-4,7-10H,5-6,11-20,29-30H2,(H,31,33)(H,32,34) |
| InChIKey | IUOIWSYQYWIENI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 181.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.63 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|