C40H36N2O8 — CID 150652492
2-[2-[[2-[2-[2-(anthracene-1-carbonyloxy)ethoxy]ethylamino]-2-oxoacetyl]amino]ethoxy]ethyl anthracene-1-carboxylate (PubChem CID 150652492) has the molecular formula C40H36N2O8 and a molecular weight of 672.73 g/mol. Its IUPAC name is 2-[2-[[2-[2-[2-(anthracene-1-carbonyloxy)ethoxy]ethylamino]-2-oxoacetyl]amino]ethoxy]ethyl anthracene-1-carboxylate.
| Compound Name | 2-[2-[[2-[2-[2-(anthracene-1-carbonyloxy)ethoxy]ethylamino]-2-oxoacetyl]amino]ethoxy]ethyl anthracene-1-carboxylate |
|---|---|
| PubChem CID | 150652492 |
| Molecular Formula | C40H36N2O8 |
| Molecular Weight | 672.73 g/mol |
| Exact Mass | 672.25 |
| IUPAC Name | 2-[2-[[2-[2-[2-(anthracene-1-carbonyloxy)ethoxy]ethylamino]-2-oxoacetyl]amino]ethoxy]ethyl anthracene-1-carboxylate |
| SMILES | O=C(NCCOCCOC(=O)c1cccc2cc3ccccc3cc12)C(=O)NCCOCCOC(=O)c1cccc2cc3ccccc3cc12 |
| InChI | InChI=1S/C40H36N2O8/c43-37(41-15-17-47-19-21-49-39(45)33-13-5-11-31-23-27-7-1-3-9-29(27)25-35(31)33)38(44)42-16-18-48-20-22-50-40(46)34-14-6-12-32-24-28-8-2-4-10-30(28)26-36(32)34/h1-14,23-26H,15-22H2,(H,41,43)(H,42,44) |
| InChIKey | JCEDEBIGSZIFJR-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.73 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|