C18H11F3O2 — CID 87129349
1-anthracen-1-yl-4,4,4-trifluorobutane-1,3-dione (PubChem CID 87129349) has the molecular formula C18H11F3O2 and a molecular weight of 316.28 g/mol. Its IUPAC name is 1-anthracen-1-yl-4,4,4-trifluorobutane-1,3-dione.
| Compound Name | 1-anthracen-1-yl-4,4,4-trifluorobutane-1,3-dione |
|---|---|
| PubChem CID | 87129349 |
| Molecular Formula | C18H11F3O2 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 1-anthracen-1-yl-4,4,4-trifluorobutane-1,3-dione |
| SMILES | O=C(CC(=O)C(F)(F)F)c1cccc2cc3ccccc3cc12 |
| InChI | InChI=1S/C18H11F3O2/c19-18(20,21)17(23)10-16(22)14-7-3-6-13-8-11-4-1-2-5-12(11)9-15(13)14/h1-9H,10H2 |
| InChIKey | SBFOPPVADKDAOP-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|