C20H18O6 — CID 174360999
(Z)-2-anthracen-1-ylbut-2-enedioic acid;ethane-1,2-diol (PubChem CID 174360999) has the molecular formula C20H18O6 and a molecular weight of 354.36 g/mol. Its IUPAC name is (Z)-2-anthracen-1-ylbut-2-enedioic acid;ethane-1,2-diol.
| Compound Name | (Z)-2-anthracen-1-ylbut-2-enedioic acid;ethane-1,2-diol |
|---|---|
| PubChem CID | 174360999 |
| Molecular Formula | C20H18O6 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | (Z)-2-anthracen-1-ylbut-2-enedioic acid;ethane-1,2-diol |
| SMILES | O=C(O)/C=C(\C(=O)O)c1cccc2cc3ccccc3cc12.OCCO |
| InChI | InChI=1S/C18H12O4.C2H6O2/c19-17(20)10-16(18(21)22)14-7-3-6-13-8-11-4-1-2-5-12(11)9-15(13)14;3-1-2-4/h1-10H,(H,19,20)(H,21,22);3-4H,1-2H2/b16-10-; |
| InChIKey | PTDKQAVRJQZXTI-HYMQDMCPSA-N |
| XLogP | 2.52 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|