C17H11NO8 — CID 150385292
(E)-2-[2-[(E)-1,2-dicarboxyethenyl]quinolin-3-yl]but-2-enedioic acid (PubChem CID 150385292) has the molecular formula C17H11NO8 and a molecular weight of 357.27 g/mol. Its IUPAC name is (E)-2-[2-[(E)-1,2-dicarboxyethenyl]quinolin-3-yl]but-2-enedioic acid.
| Compound Name | (E)-2-[2-[(E)-1,2-dicarboxyethenyl]quinolin-3-yl]but-2-enedioic acid |
|---|---|
| PubChem CID | 150385292 |
| Molecular Formula | C17H11NO8 |
| Molecular Weight | 357.27 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | (E)-2-[2-[(E)-1,2-dicarboxyethenyl]quinolin-3-yl]but-2-enedioic acid |
| SMILES | O=C(O)/C=C(/C(=O)O)c1cc2ccccc2nc1/C(=C\C(=O)O)C(=O)O |
| InChI | InChI=1S/C17H11NO8/c19-13(20)6-10(16(23)24)9-5-8-3-1-2-4-12(8)18-15(9)11(17(25)26)7-14(21)22/h1-7H,(H,19,20)(H,21,22)(H,23,24)(H,25,26)/b10-6+,11-7+ |
| InChIKey | HAOPAHRKLBLHEH-JMQWPVDRSA-N |
| XLogP | 1.34 |
| TPSA | 162.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.27 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|