About 3-benzoylquinoline-2-carbaldehyde;ethane;methane
3-benzoylquinoline-2-carbaldehyde;ethane;methane (PubChem CID 159716405) has the molecular formula C23H31NO2
and a molecular weight of 353.51 g/mol. Its IUPAC name is 3-benzoylquinoline-2-carbaldehyde;ethane;methane.
Molecular Properties
| Compound Name | 3-benzoylquinoline-2-carbaldehyde;ethane;methane |
| PubChem CID | 159716405 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | 3-benzoylquinoline-2-carbaldehyde;ethane;methane |
| SMILES | C.C.CC.CC.O=Cc1nc2ccccc2cc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C17H11NO2.2C2H6.2CH4/c19-11-16-14(17(20)12-6-2-1-3-7-12)10-13-8-4-5-9-15(13)18-16;2*1-2;;/h1-11H;2*1-2H3;2*1H4 |
| InChIKey | MZMIPZRTUKYQHC-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-benzoylquinoline-2-carbaldehyde;ethane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzoylquinoline-2-carbaldehyde;ethane;methane?
The IUPAC name of 3-benzoylquinoline-2-carbaldehyde;ethane;methane (CID 159716405) is 3-benzoylquinoline-2-carbaldehyde;ethane;methane.
What is the SMILES notation for 3-benzoylquinoline-2-carbaldehyde;ethane;methane?
The canonical SMILES for 3-benzoylquinoline-2-carbaldehyde;ethane;methane is C.C.CC.CC.O=Cc1nc2ccccc2cc1C(=O)c1ccccc1.
What is the InChIKey of 3-benzoylquinoline-2-carbaldehyde;ethane;methane?
The InChIKey is MZMIPZRTUKYQHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11NO2.2C2H6.2CH4/c19-11-16-14(17(20)12-6-2-1-3-7-12)10-13-8-4-5-9-15(13)18-16;2*1-2;;/h1-11H;2*1-2H3;2*1H4.
What are the key properties of 3-benzoylquinoline-2-carbaldehyde;ethane;methane?
3-benzoylquinoline-2-carbaldehyde;ethane;methane has a molecular weight of 353.51 g/mol, XLogP of 6.60, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzoylquinoline-2-carbaldehyde;ethane;methane is sourced from PubChem (CID 159716405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).