C31H20O3 — CID 67114355
(3,4-dibenzoylnaphthalen-2-yl)-phenylmethanone (PubChem CID 67114355) has the molecular formula C31H20O3 and a molecular weight of 440.50 g/mol. Its IUPAC name is (3,4-dibenzoylnaphthalen-2-yl)-phenylmethanone.
| Compound Name | (3,4-dibenzoylnaphthalen-2-yl)-phenylmethanone |
|---|---|
| PubChem CID | 67114355 |
| Molecular Formula | C31H20O3 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | (3,4-dibenzoylnaphthalen-2-yl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1cc2ccccc2c(C(=O)c2ccccc2)c1C(=O)c1ccccc1 |
| InChI | InChI=1S/C31H20O3/c32-29(21-12-4-1-5-13-21)26-20-24-18-10-11-19-25(24)27(30(33)22-14-6-2-7-15-22)28(26)31(34)23-16-8-3-9-17-23/h1-20H |
| InChIKey | MRIVFFVYZJUJCX-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |