C12H9NO6 — CID 174725095
formic acid;quinoline-2,3-dicarboxylic acid (PubChem CID 174725095) has the molecular formula C12H9NO6 and a molecular weight of 263.20 g/mol. Its IUPAC name is formic acid;quinoline-2,3-dicarboxylic acid.
| Compound Name | formic acid;quinoline-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174725095 |
| Molecular Formula | C12H9NO6 |
| Molecular Weight | 263.20 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | formic acid;quinoline-2,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc2ccccc2nc1C(=O)O.O=CO |
| InChI | InChI=1S/C11H7NO4.CH2O2/c13-10(14)7-5-6-3-1-2-4-8(6)12-9(7)11(15)16;2-1-3/h1-5H,(H,13,14)(H,15,16);1H,(H,2,3) |
| InChIKey | UGYOVYKJGZRGFU-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.20 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|