About formic acid;phthalic acid
formic acid;phthalic acid (PubChem CID 159829564) has the molecular formula C17H14O10
and a molecular weight of 378.29 g/mol. Its IUPAC name is formic acid;phthalic acid.
Molecular Properties
| Compound Name | formic acid;phthalic acid |
| PubChem CID | 159829564 |
| Molecular Formula | C17H14O10 |
| Molecular Weight | 378.29 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | formic acid;phthalic acid |
| SMILES | O=C(O)c1ccccc1C(=O)O.O=C(O)c1ccccc1C(=O)O.O=CO |
| InChI | InChI=1S/2C8H6O4.CH2O2/c2*9-7(10)5-3-1-2-4-6(5)8(11)12;2-1-3/h2*1-4H,(H,9,10)(H,11,12);1H,(H,2,3) |
| InChIKey | NNHBNIGRXQYSCT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 186.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formic acid;phthalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;phthalic acid?
The IUPAC name of formic acid;phthalic acid (CID 159829564) is formic acid;phthalic acid.
What is the SMILES notation for formic acid;phthalic acid?
The canonical SMILES for formic acid;phthalic acid is O=C(O)c1ccccc1C(=O)O.O=C(O)c1ccccc1C(=O)O.O=CO.
What is the InChIKey of formic acid;phthalic acid?
The InChIKey is NNHBNIGRXQYSCT-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H6O4.CH2O2/c2*9-7(10)5-3-1-2-4-6(5)8(11)12;2-1-3/h2*1-4H,(H,9,10)(H,11,12);1H,(H,2,3).
What are the key properties of formic acid;phthalic acid?
formic acid;phthalic acid has a molecular weight of 378.29 g/mol, XLogP of 1.87, 4 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;phthalic acid is sourced from PubChem (CID 159829564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).