About anthracene;ethane-1,2-diol
anthracene;ethane-1,2-diol (PubChem CID 158405305) has the molecular formula C16H16O2
and a molecular weight of 240.30 g/mol. Its IUPAC name is anthracene;ethane-1,2-diol.
Molecular Properties
| Compound Name | anthracene;ethane-1,2-diol |
| PubChem CID | 158405305 |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | anthracene;ethane-1,2-diol |
| SMILES | OCCO.c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C14H10.C2H6O2/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;3-1-2-4/h1-10H;3-4H,1-2H2 |
| InChIKey | GYPOXGXZOXXNDW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracene;ethane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene;ethane-1,2-diol?
The IUPAC name of anthracene;ethane-1,2-diol (CID 158405305) is anthracene;ethane-1,2-diol.
What is the SMILES notation for anthracene;ethane-1,2-diol?
The canonical SMILES for anthracene;ethane-1,2-diol is OCCO.c1ccc2cc3ccccc3cc2c1.
What is the InChIKey of anthracene;ethane-1,2-diol?
The InChIKey is GYPOXGXZOXXNDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.C2H6O2/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;3-1-2-4/h1-10H;3-4H,1-2H2.
What are the key properties of anthracene;ethane-1,2-diol?
anthracene;ethane-1,2-diol has a molecular weight of 240.30 g/mol, XLogP of 2.96, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene;ethane-1,2-diol is sourced from PubChem (CID 158405305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).