C17H12EuF3O2- — CID 20798412
carbanide;europium;2,2,2-trifluoro-1-(1-hydroxyanthracen-2-yl)ethanone (PubChem CID 20798412) has the molecular formula C17H12EuF3O2- and a molecular weight of 457.24 g/mol. Its IUPAC name is carbanide;europium;2,2,2-trifluoro-1-(1-hydroxyanthracen-2-yl)ethanone.
| Compound Name | carbanide;europium;2,2,2-trifluoro-1-(1-hydroxyanthracen-2-yl)ethanone |
|---|---|
| PubChem CID | 20798412 |
| Molecular Formula | C17H12EuF3O2- |
| Molecular Weight | 457.24 g/mol |
| Exact Mass | 458.00 |
| IUPAC Name | carbanide;europium;2,2,2-trifluoro-1-(1-hydroxyanthracen-2-yl)ethanone |
| SMILES | O=C(c1ccc2cc3ccccc3cc2c1O)C(F)(F)F.[CH3-].[Eu] |
| InChI | InChI=1S/C16H9F3O2.CH3.Eu/c17-16(18,19)15(21)12-6-5-11-7-9-3-1-2-4-10(9)8-13(11)14(12)20;;/h1-8,20H;1H3;/q;-1; |
| InChIKey | ATPPSVZEPCSKLJ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.24 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|