C16H14F3NO — CID 177471607
2,2,2-trifluoro-1-(1-pyrrolidin-1-ylnaphthalen-2-yl)ethanone (PubChem CID 177471607) has the molecular formula C16H14F3NO and a molecular weight of 293.29 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(1-pyrrolidin-1-ylnaphthalen-2-yl)ethanone.
| Compound Name | 2,2,2-trifluoro-1-(1-pyrrolidin-1-ylnaphthalen-2-yl)ethanone |
|---|---|
| PubChem CID | 177471607 |
| Molecular Formula | C16H14F3NO |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 2,2,2-trifluoro-1-(1-pyrrolidin-1-ylnaphthalen-2-yl)ethanone |
| SMILES | O=C(c1ccc2ccccc2c1N1CCCC1)C(F)(F)F |
| InChI | InChI=1S/C16H14F3NO/c17-16(18,19)15(21)13-8-7-11-5-1-2-6-12(11)14(13)20-9-3-4-10-20/h1-2,5-8H,3-4,9-10H2 |
| InChIKey | RLMNJNVIQVQTAX-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |