C25H27F3N2O4 — CID 166480435
(2Z)-6,7,8-trihydroxy-3-oxo-2-[2,2,2-trifluoro-1-(1-piperidin-1-ylnaphthalen-2-yl)ethylidene]octanenitrile (PubChem CID 166480435) has the molecular formula C25H27F3N2O4 and a molecular weight of 476.50 g/mol. Its IUPAC name is (2Z)-6,7,8-trihydroxy-3-oxo-2-[2,2,2-trifluoro-1-(1-piperidin-1-ylnaphthalen-2-yl)ethylidene]octanenitrile.
| Compound Name | (2Z)-6,7,8-trihydroxy-3-oxo-2-[2,2,2-trifluoro-1-(1-piperidin-1-ylnaphthalen-2-yl)ethylidene]octanenitrile |
|---|---|
| PubChem CID | 166480435 |
| Molecular Formula | C25H27F3N2O4 |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | (2Z)-6,7,8-trihydroxy-3-oxo-2-[2,2,2-trifluoro-1-(1-piperidin-1-ylnaphthalen-2-yl)ethylidene]octanenitrile |
| SMILES | N#C/C(C(=O)CCC(O)C(O)CO)=C(\c1ccc2ccccc2c1N1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C25H27F3N2O4/c26-25(27,28)23(19(14-29)20(32)10-11-21(33)22(34)15-31)18-9-8-16-6-2-3-7-17(16)24(18)30-12-4-1-5-13-30/h2-3,6-9,21-22,31,33-34H,1,4-5,10-13,15H2/b23-19- |
| InChIKey | WHAVSVAOKGTZFF-NMWGTECJSA-N |
| XLogP | 3.73 |
| TPSA | 104.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|