C22H21F3N2O4 — CID 166480427
(2Z)-2-[1-[6-(aziridin-1-yl)naphthalen-2-yl]-2,2,2-trifluoroethylidene]-6,7,8-trihydroxy-3-oxooctanenitrile (PubChem CID 166480427) has the molecular formula C22H21F3N2O4 and a molecular weight of 434.41 g/mol. Its IUPAC name is (2Z)-2-[1-[6-(aziridin-1-yl)naphthalen-2-yl]-2,2,2-trifluoroethylidene]-6,7,8-trihydroxy-3-oxooctanenitrile.
| Compound Name | (2Z)-2-[1-[6-(aziridin-1-yl)naphthalen-2-yl]-2,2,2-trifluoroethylidene]-6,7,8-trihydroxy-3-oxooctanenitrile |
|---|---|
| PubChem CID | 166480427 |
| Molecular Formula | C22H21F3N2O4 |
| Molecular Weight | 434.41 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | (2Z)-2-[1-[6-(aziridin-1-yl)naphthalen-2-yl]-2,2,2-trifluoroethylidene]-6,7,8-trihydroxy-3-oxooctanenitrile |
| SMILES | N#C/C(C(=O)CCC(O)C(O)CO)=C(\c1ccc2cc(N3CC3)ccc2c1)C(F)(F)F |
| InChI | InChI=1S/C22H21F3N2O4/c23-22(24,25)21(17(11-26)18(29)5-6-19(30)20(31)12-28)15-2-1-14-10-16(27-7-8-27)4-3-13(14)9-15/h1-4,9-10,19-20,28,30-31H,5-8,12H2/b21-17- |
| InChIKey | NRXVGTBCNXUGCK-FXBPSFAMSA-N |
| XLogP | 2.56 |
| TPSA | 104.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|