4-[4-[(2S)-2,3-dihydroxypropyl]piperazin-1-yl]benzoic acid

C14H20N2O4 — CID 138039616

IUPAC4-[4-[(2S)-2,3-dihydroxypropyl]piperazin-1-yl]benzoic acid
SMILESO=C(O)c1ccc(N2CCN(C[C@H](O)CO)CC2)cc1
InChIInChI=1S/C14H20N2O4/c17-10-13(18)9-15-5-7-16(8-6-15)12-3-1-11(2-4-12)14(19)20/h1-4,13,17-18H,5-10H2,(H,19,20)/t13-/m0/s1
InChIKeyZRQKHLBKWYJSMW-ZDUSSCGKSA-N
MW280.32 g/mol
LogP-0.14
Rot. Bonds5

About 4-[4-[(2S)-2,3-dihydroxypropyl]piperazin-1-yl]benzoic acid

4-[4-[(2S)-2,3-dihydroxypropyl]piperazin-1-yl]benzoic acid (PubChem CID 138039616) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is 4-[4-[(2S)-2,3-dihydroxypropyl]piperazin-1-yl]benzoic acid.

Molecular Properties

Compound Name4-[4-[(2S)-2,3-dihydroxypropyl]piperazin-1-yl]benzoic acid
PubChem CID138039616
Molecular FormulaC14H20N2O4
Molecular Weight280.32 g/mol
Exact Mass280.14
IUPAC Name4-[4-[(2S)-2,3-dihydroxypropyl]piperazin-1-yl]benzoic acid
SMILESO=C(O)c1ccc(N2CCN(C[C@H](O)CO)CC2)cc1
InChIInChI=1S/C14H20N2O4/c17-10-13(18)9-15-5-7-16(8-6-15)12-3-1-11(2-4-12)14(19)20/h1-4,13,17-18H,5-10H2,(H,19,20)/t13-/m0/s1
InChIKeyZRQKHLBKWYJSMW-ZDUSSCGKSA-N
XLogP-0.14
TPSA84.24 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500280.32
LogP ≤ 5-0.14
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 4-[4-[(2S)-2,3-dihydroxypropyl]piperazin-1-yl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[4-[(2S)-2,3-dihydroxypropyl]piperazin-1-yl]benzoic acid?
The IUPAC name of 4-[4-[(2S)-2,3-dihydroxypropyl]piperazin-1-yl]benzoic acid (CID 138039616) is 4-[4-[(2S)-2,3-dihydroxypropyl]piperazin-1-yl]benzoic acid.
What is the SMILES notation for 4-[4-[(2S)-2,3-dihydroxypropyl]piperazin-1-yl]benzoic acid?
The canonical SMILES for 4-[4-[(2S)-2,3-dihydroxypropyl]piperazin-1-yl]benzoic acid is O=C(O)c1ccc(N2CCN(C[C@H](O)CO)CC2)cc1.
What is the InChIKey of 4-[4-[(2S)-2,3-dihydroxypropyl]piperazin-1-yl]benzoic acid?
The InChIKey is ZRQKHLBKWYJSMW-ZDUSSCGKSA-N. The full InChI is InChI=1S/C14H20N2O4/c17-10-13(18)9-15-5-7-16(8-6-15)12-3-1-11(2-4-12)14(19)20/h1-4,13,17-18H,5-10H2,(H,19,20)/t13-/m0/s1.
What are the key properties of 4-[4-[(2S)-2,3-dihydroxypropyl]piperazin-1-yl]benzoic acid?
4-[4-[(2S)-2,3-dihydroxypropyl]piperazin-1-yl]benzoic acid has a molecular weight of 280.32 g/mol, XLogP of -0.14, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[(2S)-2,3-dihydroxypropyl]piperazin-1-yl]benzoic acid is sourced from PubChem (CID 138039616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).