C14H20N2O4 — CID 138039616
4-[4-[(2S)-2,3-dihydroxypropyl]piperazin-1-yl]benzoic acid (PubChem CID 138039616) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is 4-[4-[(2S)-2,3-dihydroxypropyl]piperazin-1-yl]benzoic acid.
| Compound Name | 4-[4-[(2S)-2,3-dihydroxypropyl]piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 138039616 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 4-[4-[(2S)-2,3-dihydroxypropyl]piperazin-1-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(N2CCN(C[C@H](O)CO)CC2)cc1 |
| InChI | InChI=1S/C14H20N2O4/c17-10-13(18)9-15-5-7-16(8-6-15)12-3-1-11(2-4-12)14(19)20/h1-4,13,17-18H,5-10H2,(H,19,20)/t13-/m0/s1 |
| InChIKey | ZRQKHLBKWYJSMW-ZDUSSCGKSA-N |
| XLogP | -0.14 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |