C21H31N5O2 — CID 23103836
3-[4,7-bis(4-aminophenyl)-1,4,7-triazonan-1-yl]propane-1,2-diol (PubChem CID 23103836) has the molecular formula C21H31N5O2 and a molecular weight of 385.51 g/mol. Its IUPAC name is 3-[4,7-bis(4-aminophenyl)-1,4,7-triazonan-1-yl]propane-1,2-diol.
| Compound Name | 3-[4,7-bis(4-aminophenyl)-1,4,7-triazonan-1-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 23103836 |
| Molecular Formula | C21H31N5O2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | 3-[4,7-bis(4-aminophenyl)-1,4,7-triazonan-1-yl]propane-1,2-diol |
| SMILES | Nc1ccc(N2CCN(CC(O)CO)CCN(c3ccc(N)cc3)CC2)cc1 |
| InChI | InChI=1S/C21H31N5O2/c22-17-1-5-19(6-2-17)25-11-9-24(15-21(28)16-27)10-12-26(14-13-25)20-7-3-18(23)4-8-20/h1-8,21,27-28H,9-16,22-23H2 |
| InChIKey | GECBOYGTJPGFBP-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|