C21H25N3O5S — CID 123858773
1-cyano-N-(2,3-dihydroxypropyl)-2-(6-morpholin-4-ylnaphthalen-2-yl)prop-1-ene-1-sulfonamide (PubChem CID 123858773) has the molecular formula C21H25N3O5S and a molecular weight of 431.51 g/mol. Its IUPAC name is 1-cyano-N-(2,3-dihydroxypropyl)-2-(6-morpholin-4-ylnaphthalen-2-yl)prop-1-ene-1-sulfonamide.
| Compound Name | 1-cyano-N-(2,3-dihydroxypropyl)-2-(6-morpholin-4-ylnaphthalen-2-yl)prop-1-ene-1-sulfonamide |
|---|---|
| PubChem CID | 123858773 |
| Molecular Formula | C21H25N3O5S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 1-cyano-N-(2,3-dihydroxypropyl)-2-(6-morpholin-4-ylnaphthalen-2-yl)prop-1-ene-1-sulfonamide |
| SMILES | CC(=C(C#N)S(=O)(=O)NCC(O)CO)c1ccc2cc(N3CCOCC3)ccc2c1 |
| InChI | InChI=1S/C21H25N3O5S/c1-15(21(12-22)30(27,28)23-13-20(26)14-25)16-2-3-18-11-19(5-4-17(18)10-16)24-6-8-29-9-7-24/h2-5,10-11,20,23,25-26H,6-9,13-14H2,1H3 |
| InChIKey | TZRXWEHXNBELMA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 122.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|