C24H29N3O8S — CID 123235429
1-cyano-2-(6-morpholin-4-ylnaphthalen-2-yl)-N-[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]prop-1-ene-1-sulfonamide (PubChem CID 123235429) has the molecular formula C24H29N3O8S and a molecular weight of 519.58 g/mol. Its IUPAC name is 1-cyano-2-(6-morpholin-4-ylnaphthalen-2-yl)-N-[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]prop-1-ene-1-sulfonamide.
| Compound Name | 1-cyano-2-(6-morpholin-4-ylnaphthalen-2-yl)-N-[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]prop-1-ene-1-sulfonamide |
|---|---|
| PubChem CID | 123235429 |
| Molecular Formula | C24H29N3O8S |
| Molecular Weight | 519.58 g/mol |
| Exact Mass | 519.17 |
| IUPAC Name | 1-cyano-2-(6-morpholin-4-ylnaphthalen-2-yl)-N-[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]prop-1-ene-1-sulfonamide |
| SMILES | CC(=C(C#N)S(=O)(=O)NC1C(O)OC(CO)C(O)C1O)c1ccc2cc(N3CCOCC3)ccc2c1 |
| InChI | InChI=1S/C24H29N3O8S/c1-14(15-2-3-17-11-18(5-4-16(17)10-15)27-6-8-34-9-7-27)20(12-25)36(32,33)26-21-23(30)22(29)19(13-28)35-24(21)31/h2-5,10-11,19,21-24,26,28-31H,6-9,13H2,1H3 |
| InChIKey | HEGKVYHBHKGMMF-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 172.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.58 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|