C30H36N4O9S — CID 122683916
(E)-1-cyano-2-[5-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]furan-2-yl]-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]prop-1-ene-1-sulfonamide (PubChem CID 122683916) has the molecular formula C30H36N4O9S and a molecular weight of 628.70 g/mol. Its IUPAC name is (E)-1-cyano-2-[5-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]furan-2-yl]-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]prop-1-ene-1-sulfonamide.
| Compound Name | (E)-1-cyano-2-[5-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]furan-2-yl]-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]prop-1-ene-1-sulfonamide |
|---|---|
| PubChem CID | 122683916 |
| Molecular Formula | C30H36N4O9S |
| Molecular Weight | 628.70 g/mol |
| Exact Mass | 628.22 |
| IUPAC Name | (E)-1-cyano-2-[5-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]furan-2-yl]-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]prop-1-ene-1-sulfonamide |
| SMILES | C/C(=C(/C#N)S(=O)(=O)N[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O)c1ccc(-c2ccc3cc(NCCN4CCOCC4)ccc3c2)o1 |
| InChI | InChI=1S/C30H36N4O9S/c1-18(26(16-31)44(39,40)33-27-29(37)28(36)25(17-35)43-30(27)38)23-6-7-24(42-23)21-3-2-20-15-22(5-4-19(20)14-21)32-8-9-34-10-12-41-13-11-34/h2-7,14-15,25,27-30,32-33,35-38H,8-13,17H2,1H3/b26-18+/t25-,27-,28-,29-,30?/m1/s1 |
| InChIKey | ZRMMCOISPZJVDR-YHYZTEGPSA-N |
| XLogP | 0.82 |
| TPSA | 197.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.70 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|