C22H32N4O7S — CID 122682676
(E)-1-cyano-N-[(3R,4R,5S,6R)-6-ethyl-2,4,5-trihydroxyoxan-3-yl]-2-[4-(2-morpholin-4-ylethylamino)phenyl]ethenesulfonamide (PubChem CID 122682676) has the molecular formula C22H32N4O7S and a molecular weight of 496.59 g/mol. Its IUPAC name is (E)-1-cyano-N-[(3R,4R,5S,6R)-6-ethyl-2,4,5-trihydroxyoxan-3-yl]-2-[4-(2-morpholin-4-ylethylamino)phenyl]ethenesulfonamide.
| Compound Name | (E)-1-cyano-N-[(3R,4R,5S,6R)-6-ethyl-2,4,5-trihydroxyoxan-3-yl]-2-[4-(2-morpholin-4-ylethylamino)phenyl]ethenesulfonamide |
|---|---|
| PubChem CID | 122682676 |
| Molecular Formula | C22H32N4O7S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | (E)-1-cyano-N-[(3R,4R,5S,6R)-6-ethyl-2,4,5-trihydroxyoxan-3-yl]-2-[4-(2-morpholin-4-ylethylamino)phenyl]ethenesulfonamide |
| SMILES | CC[C@H]1OC(O)[C@H](NS(=O)(=O)/C(C#N)=C/c2ccc(NCCN3CCOCC3)cc2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H32N4O7S/c1-2-18-20(27)21(28)19(22(29)33-18)25-34(30,31)17(14-23)13-15-3-5-16(6-4-15)24-7-8-26-9-11-32-12-10-26/h3-6,13,18-22,24-25,27-29H,2,7-12H2,1H3/b17-13+/t18-,19-,20-,21-,22?/m1/s1 |
| InChIKey | XQHTYBHCNCLDFC-NDVWGBJTSA-N |
| XLogP | -0.57 |
| TPSA | 164.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|