C24H34N4O6 — CID 122682702
(E)-2-cyano-N-[(3R,4R,5S,6R)-6-ethyl-2,4,5-trihydroxyoxan-3-yl]-3-[4-(2-morpholin-4-ylethylamino)phenyl]but-2-enamide (PubChem CID 122682702) has the molecular formula C24H34N4O6 and a molecular weight of 474.56 g/mol. Its IUPAC name is (E)-2-cyano-N-[(3R,4R,5S,6R)-6-ethyl-2,4,5-trihydroxyoxan-3-yl]-3-[4-(2-morpholin-4-ylethylamino)phenyl]but-2-enamide.
| Compound Name | (E)-2-cyano-N-[(3R,4R,5S,6R)-6-ethyl-2,4,5-trihydroxyoxan-3-yl]-3-[4-(2-morpholin-4-ylethylamino)phenyl]but-2-enamide |
|---|---|
| PubChem CID | 122682702 |
| Molecular Formula | C24H34N4O6 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | (E)-2-cyano-N-[(3R,4R,5S,6R)-6-ethyl-2,4,5-trihydroxyoxan-3-yl]-3-[4-(2-morpholin-4-ylethylamino)phenyl]but-2-enamide |
| SMILES | CC[C@H]1OC(O)[C@H](NC(=O)/C(C#N)=C(\C)c2ccc(NCCN3CCOCC3)cc2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H34N4O6/c1-3-19-21(29)22(30)20(24(32)34-19)27-23(31)18(14-25)15(2)16-4-6-17(7-5-16)26-8-9-28-10-12-33-13-11-28/h4-7,19-22,24,26,29-30,32H,3,8-13H2,1-2H3,(H,27,31)/b18-15+/t19-,20-,21-,22-,24?/m1/s1 |
| InChIKey | INVMDXVNZWLWBJ-FDNRJIDGSA-N |
| XLogP | 0.06 |
| TPSA | 147.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|