C27H34N4O7 — CID 130375213
(E)-2-cyano-3-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]but-2-enamide (PubChem CID 130375213) has the molecular formula C27H34N4O7 and a molecular weight of 526.59 g/mol. Its IUPAC name is (E)-2-cyano-3-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]but-2-enamide.
| Compound Name | (E)-2-cyano-3-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]but-2-enamide |
|---|---|
| PubChem CID | 130375213 |
| Molecular Formula | C27H34N4O7 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | (E)-2-cyano-3-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]but-2-enamide |
| SMILES | C/C(=C(/C#N)C(=O)N[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O)c1ccc2cc(NCCN3CCOCC3)ccc2c1 |
| InChI | InChI=1S/C27H34N4O7/c1-16(21(14-28)26(35)30-23-25(34)24(33)22(15-32)38-27(23)36)17-2-3-19-13-20(5-4-18(19)12-17)29-6-7-31-8-10-37-11-9-31/h2-5,12-13,22-25,27,29,32-34,36H,6-11,15H2,1H3,(H,30,35)/b21-16+/t22-,23-,24-,25-,27?/m1/s1 |
| InChIKey | NQVDOEMRHJPRFO-ZCLNHYLOSA-N |
| XLogP | -0.20 |
| TPSA | 167.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|