C26H36N4O5S — CID 144928102
(E)-2-[(2,5-dihydroxyoxan-3-yl)amino]sulfanyl-3-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]but-2-enenitrile;methanol (PubChem CID 144928102) has the molecular formula C26H36N4O5S and a molecular weight of 516.66 g/mol. Its IUPAC name is (E)-2-[(2,5-dihydroxyoxan-3-yl)amino]sulfanyl-3-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]but-2-enenitrile;methanol.
| Compound Name | (E)-2-[(2,5-dihydroxyoxan-3-yl)amino]sulfanyl-3-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]but-2-enenitrile;methanol |
|---|---|
| PubChem CID | 144928102 |
| Molecular Formula | C26H36N4O5S |
| Molecular Weight | 516.66 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | (E)-2-[(2,5-dihydroxyoxan-3-yl)amino]sulfanyl-3-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]but-2-enenitrile;methanol |
| SMILES | C/C(=C(/C#N)SNC1CC(O)COC1O)c1ccc2cc(NCCN3CCOCC3)ccc2c1.CO |
| InChI | InChI=1S/C25H32N4O4S.CH4O/c1-17(24(15-26)34-28-23-14-22(30)16-33-25(23)31)18-2-3-20-13-21(5-4-19(20)12-18)27-6-7-29-8-10-32-11-9-29;1-2/h2-5,12-13,22-23,25,27-28,30-31H,6-11,14,16H2,1H3;2H,1H3/b24-17+; |
| InChIKey | KNDWQPLJNCXBMW-HRKWZSCTSA-N |
| XLogP | 2.15 |
| TPSA | 130.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.66 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|