C23H30N4O3S — CID 144927875
(E)-2-(2,3-dihydroxypropylamino)sulfanyl-3-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]but-2-enenitrile (PubChem CID 144927875) has the molecular formula C23H30N4O3S and a molecular weight of 442.59 g/mol. Its IUPAC name is (E)-2-(2,3-dihydroxypropylamino)sulfanyl-3-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]but-2-enenitrile.
| Compound Name | (E)-2-(2,3-dihydroxypropylamino)sulfanyl-3-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]but-2-enenitrile |
|---|---|
| PubChem CID | 144927875 |
| Molecular Formula | C23H30N4O3S |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | (E)-2-(2,3-dihydroxypropylamino)sulfanyl-3-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]but-2-enenitrile |
| SMILES | C/C(=C(/C#N)SNCC(O)CO)c1ccc2cc(NCCN3CCOCC3)ccc2c1 |
| InChI | InChI=1S/C23H30N4O3S/c1-17(23(14-24)31-26-15-22(29)16-28)18-2-3-20-13-21(5-4-19(20)12-18)25-6-7-27-8-10-30-11-9-27/h2-5,12-13,22,25-26,28-29H,6-11,15-16H2,1H3/b23-17+ |
| InChIKey | GAWVDUFIIFXTCU-HAVVHWLPSA-N |
| XLogP | 2.43 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|