C27H30N4O4S — CID 123143094
2-cyano-N-(2,3-dihydroxypropyl)-3-[5-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]thiophen-2-yl]prop-2-enamide (PubChem CID 123143094) has the molecular formula C27H30N4O4S and a molecular weight of 506.63 g/mol. Its IUPAC name is 2-cyano-N-(2,3-dihydroxypropyl)-3-[5-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]thiophen-2-yl]prop-2-enamide.
| Compound Name | 2-cyano-N-(2,3-dihydroxypropyl)-3-[5-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]thiophen-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 123143094 |
| Molecular Formula | C27H30N4O4S |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | 2-cyano-N-(2,3-dihydroxypropyl)-3-[5-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]thiophen-2-yl]prop-2-enamide |
| SMILES | N#CC(=Cc1ccc(-c2ccc3cc(NCCN4CCOCC4)ccc3c2)s1)C(=O)NCC(O)CO |
| InChI | InChI=1S/C27H30N4O4S/c28-16-22(27(34)30-17-24(33)18-32)15-25-5-6-26(36-25)21-2-1-20-14-23(4-3-19(20)13-21)29-7-8-31-9-11-35-12-10-31/h1-6,13-15,24,29,32-33H,7-12,17-18H2,(H,30,34) |
| InChIKey | BCXZGVSWOAYWNU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|