C23H28N4O4 — CID 123343494
2-cyano-N-(2,3-dihydroxypropyl)-3-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]prop-2-enamide (PubChem CID 123343494) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is 2-cyano-N-(2,3-dihydroxypropyl)-3-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]prop-2-enamide.
| Compound Name | 2-cyano-N-(2,3-dihydroxypropyl)-3-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 123343494 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 2-cyano-N-(2,3-dihydroxypropyl)-3-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]prop-2-enamide |
| SMILES | N#CC(=Cc1ccc2cc(NCCN3CCOCC3)ccc2c1)C(=O)NCC(O)CO |
| InChI | InChI=1S/C23H28N4O4/c24-14-20(23(30)26-15-22(29)16-28)12-17-1-2-19-13-21(4-3-18(19)11-17)25-5-6-27-7-9-31-10-8-27/h1-4,11-13,22,25,28-29H,5-10,15-16H2,(H,26,30) |
| InChIKey | WTOCPEHPBWDUKM-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|