C22H25N3O3 — CID 122682464
(E)-2-cyano-N-(2-hydroxybutyl)-3-(6-morpholin-4-ylnaphthalen-2-yl)prop-2-enamide (PubChem CID 122682464) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is (E)-2-cyano-N-(2-hydroxybutyl)-3-(6-morpholin-4-ylnaphthalen-2-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(2-hydroxybutyl)-3-(6-morpholin-4-ylnaphthalen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 122682464 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | (E)-2-cyano-N-(2-hydroxybutyl)-3-(6-morpholin-4-ylnaphthalen-2-yl)prop-2-enamide |
| SMILES | CCC(O)CNC(=O)/C(C#N)=C/c1ccc2cc(N3CCOCC3)ccc2c1 |
| InChI | InChI=1S/C22H25N3O3/c1-2-21(26)15-24-22(27)19(14-23)12-16-3-4-18-13-20(6-5-17(18)11-16)25-7-9-28-10-8-25/h3-6,11-13,21,26H,2,7-10,15H2,1H3,(H,24,27)/b19-12+ |
| InChIKey | PGXZZRXQPCSWJJ-XDHOZWIPSA-N |
| XLogP | 2.47 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|